C19H15F9O — CID 22440512
2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene (PubChem CID 22440512) has the molecular formula C19H15F9O and a molecular weight of 430.31 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 22440512 |
| Molecular Formula | C19H15F9O |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C(F)(F)Oc2cc(F)c(C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C19H15F9O/c1-2-3-4-5-10-6-12(20)17(13(21)7-10)19(27,28)29-11-8-14(22)16(15(23)9-11)18(24,25)26/h6-9H,2-5H2,1H3 |
| InChIKey | CEVYEORRBXGLOR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|