C21H17F9O2 — CID 123841253
2-[[3,5-difluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene (PubChem CID 123841253) has the molecular formula C21H17F9O2 and a molecular weight of 472.35 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[[3,5-difluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 123841253 |
| Molecular Formula | C21H17F9O2 |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[[3,5-difluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C(F)(F)Oc2cc(F)c(OC=CC(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C21H17F9O2/c1-2-3-4-5-12-8-14(22)18(15(23)9-12)21(29,30)32-13-10-16(24)19(17(25)11-13)31-7-6-20(26,27)28/h6-11H,2-5H2,1H3 |
| InChIKey | QLJWIZHQXRCFNU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|