C21H19F7O4 — CID 126725199
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methyl-5-propyl-1,3-dioxan-2-ol (PubChem CID 126725199) has the molecular formula C21H19F7O4 and a molecular weight of 468.37 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methyl-5-propyl-1,3-dioxan-2-ol.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methyl-5-propyl-1,3-dioxan-2-ol |
|---|---|
| PubChem CID | 126725199 |
| Molecular Formula | C21H19F7O4 |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methyl-5-propyl-1,3-dioxan-2-ol |
| SMILES | CCCC1(C)COC(O)(c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C21H19F7O4/c1-3-4-19(2)9-30-21(29,31-10-19)11-5-13(22)17(14(23)6-11)20(27,28)32-12-7-15(24)18(26)16(25)8-12/h5-8,29H,3-4,9-10H2,1-2H3 |
| InChIKey | PYLREXGGBMPRAU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|