C35H26F10O4 — CID 88990816
1-[4-[[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 88990816) has the molecular formula C35H26F10O4 and a molecular weight of 700.57 g/mol. Its IUPAC name is 1-[4-[[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 88990816 |
| Molecular Formula | C35H26F10O4 |
| Molecular Weight | 700.57 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | 1-[4-[[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCCCC12COC(c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(-c6cc(F)c(F)c(F)c6)c(F)c5)c(F)c4)c(F)c3)(OC1)OC2 |
| InChI | InChI=1S/C35H26F10O4/c1-2-3-4-7-33-15-46-35(47-16-33,48-17-33)20-12-26(39)31(27(40)13-20)34(44,45)49-21-5-6-22(23(36)14-21)18-8-24(37)30(25(38)9-18)19-10-28(41)32(43)29(42)11-19/h5-6,8-14H,2-4,7,15-17H2,1H3 |
| InChIKey | YFMFZJULZBYYAF-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.57 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|