C29H24F8O4 — CID 88990775
1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 88990775) has the molecular formula C29H24F8O4 and a molecular weight of 588.49 g/mol. Its IUPAC name is 1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 88990775 |
| Molecular Formula | C29H24F8O4 |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCCCC12COC(c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)(OC1)OC2 |
| InChI | InChI=1S/C29H24F8O4/c1-2-3-4-7-27-13-38-29(39-14-27,40-15-27)17-10-21(31)25(22(32)11-17)28(36,37)41-18-5-6-19(20(30)12-18)16-8-23(33)26(35)24(34)9-16/h5-6,8-12H,2-4,7,13-15H2,1H3 |
| InChIKey | INWWUMGJLQSTAR-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|