C35H38F6O4 — CID 126725216
2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]phenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol (PubChem CID 126725216) has the molecular formula C35H38F6O4 and a molecular weight of 636.67 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]phenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol.
| Compound Name | 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]phenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol |
|---|---|
| PubChem CID | 126725216 |
| Molecular Formula | C35H38F6O4 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | 2-[4-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]phenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol |
| SMILES | CCCCCC1(C)COC(O)(C2CCC(c3ccc(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)cc3)CC2)OC1 |
| InChI | InChI=1S/C35H38F6O4/c1-3-4-5-16-33(2)20-43-35(42,44-21-33)26-12-8-23(9-13-26)22-6-10-25(11-7-22)34(40,41)45-27-14-15-28(29(36)19-27)24-17-30(37)32(39)31(38)18-24/h6-7,10-11,14-15,17-19,23,26,42H,3-5,8-9,12-13,16,20-21H2,1-2H3 |
| InChIKey | SXKCAQRMPLWUQQ-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|