C34H36F6O3 — CID 126725169
2-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol (PubChem CID 126725169) has the molecular formula C34H36F6O3 and a molecular weight of 606.65 g/mol. Its IUPAC name is 2-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol.
| Compound Name | 2-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol |
|---|---|
| PubChem CID | 126725169 |
| Molecular Formula | C34H36F6O3 |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 2-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol |
| SMILES | CCCCCC1(C)COC(O)(C2CCC(c3ccc(-c4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C34H36F6O3/c1-3-4-5-12-33(2)18-42-34(41,43-19-33)24-9-6-20(7-10-24)21-8-11-25(26(35)13-21)22-14-27(36)31(28(37)15-22)23-16-29(38)32(40)30(39)17-23/h8,11,13-17,20,24,41H,3-7,9-10,12,18-19H2,1-2H3 |
| InChIKey | OZYVRYJBDZKGQY-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|