C22H24F4O3 — CID 126725287
2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-methyl-5-propyl-1,3-dioxan-2-ol (PubChem CID 126725287) has the molecular formula C22H24F4O3 and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-methyl-5-propyl-1,3-dioxan-2-ol.
| Compound Name | 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-methyl-5-propyl-1,3-dioxan-2-ol |
|---|---|
| PubChem CID | 126725287 |
| Molecular Formula | C22H24F4O3 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-methyl-5-propyl-1,3-dioxan-2-ol |
| SMILES | CCCC1(C)COC(O)(CCc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H24F4O3/c1-3-7-21(2)12-28-22(27,29-13-21)8-6-14-4-5-16(17(23)9-14)15-10-18(24)20(26)19(25)11-15/h4-5,9-11,27H,3,6-8,12-13H2,1-2H3 |
| InChIKey | JDLYPNFJZFJZJQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|