C28H26F6O3 — CID 126725203
2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol (PubChem CID 126725203) has the molecular formula C28H26F6O3 and a molecular weight of 524.50 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol.
| Compound Name | 2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol |
|---|---|
| PubChem CID | 126725203 |
| Molecular Formula | C28H26F6O3 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]-5-methyl-5-pentyl-1,3-dioxan-2-ol |
| SMILES | CCCCCC1(C)COC(O)(c2ccc(-c3cc(F)c(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C28H26F6O3/c1-3-4-5-8-27(2)14-36-28(35,37-15-27)18-6-7-19(20(29)13-18)16-9-21(30)25(22(31)10-16)17-11-23(32)26(34)24(33)12-17/h6-7,9-13,35H,3-5,8,14-15H2,1-2H3 |
| InChIKey | YXWOVNKFXSXLBA-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|