C29H20F8 — CID 118593552
1-[4-(2,6-difluoro-4-pentylphenyl)-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene (PubChem CID 118593552) has the molecular formula C29H20F8 and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-[4-(2,6-difluoro-4-pentylphenyl)-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-[4-(2,6-difluoro-4-pentylphenyl)-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118593552 |
| Molecular Formula | C29H20F8 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 1-[4-(2,6-difluoro-4-pentylphenyl)-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
| SMILES | CCCCCc1cc(F)c(-c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H20F8/c1-2-3-4-5-15-10-22(31)26(23(32)11-15)16-6-7-19(21(30)12-16)20-9-8-18(27(35)28(20)36)17-13-24(33)29(37)25(34)14-17/h6-14H,2-5H2,1H3 |
| InChIKey | PHWMEKTUNFIXDV-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|