C16H19F3O3 — CID 70810874
4-propyl-1-[2-(3,4,5-trifluorophenyl)ethyl]-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 70810874) has the molecular formula C16H19F3O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-propyl-1-[2-(3,4,5-trifluorophenyl)ethyl]-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 4-propyl-1-[2-(3,4,5-trifluorophenyl)ethyl]-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 70810874 |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-propyl-1-[2-(3,4,5-trifluorophenyl)ethyl]-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCC12COC(CCc3cc(F)c(F)c(F)c3)(OC1)OC2 |
| InChI | InChI=1S/C16H19F3O3/c1-2-4-15-8-20-16(21-9-15,22-10-15)5-3-11-6-12(17)14(19)13(18)7-11/h6-7H,2-5,8-10H2,1H3 |
| InChIKey | QZDZRWKDGJQSCF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|