C27H21F5O5 — CID 88990811
(3,4,5-trifluorophenyl) 2,6-difluoro-4-[4-(4-propyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]benzoate (PubChem CID 88990811) has the molecular formula C27H21F5O5 and a molecular weight of 520.45 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2,6-difluoro-4-[4-(4-propyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 2,6-difluoro-4-[4-(4-propyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 88990811 |
| Molecular Formula | C27H21F5O5 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2,6-difluoro-4-[4-(4-propyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]benzoate |
| SMILES | CCCC12COC(c3ccc(-c4cc(F)c(C(=O)Oc5cc(F)c(F)c(F)c5)c(F)c4)cc3)(OC1)OC2 |
| InChI | InChI=1S/C27H21F5O5/c1-2-7-26-12-34-27(35-13-26,36-14-26)17-5-3-15(4-6-17)16-8-19(28)23(20(29)9-16)25(33)37-18-10-21(30)24(32)22(31)11-18/h3-6,8-11H,2,7,12-14H2,1H3 |
| InChIKey | RTQFPEDOQMRVDD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|