C25H15F7O2 — CID 59246888
[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl] 2,6-difluoro-4-(4-propylphenyl)benzoate (PubChem CID 59246888) has the molecular formula C25H15F7O2 and a molecular weight of 480.38 g/mol. Its IUPAC name is [3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl] 2,6-difluoro-4-(4-propylphenyl)benzoate.
| Compound Name | [3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl] 2,6-difluoro-4-(4-propylphenyl)benzoate |
|---|---|
| PubChem CID | 59246888 |
| Molecular Formula | C25H15F7O2 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl] 2,6-difluoro-4-(4-propylphenyl)benzoate |
| SMILES | CCCc1ccc(-c2cc(F)c(C(=O)Oc3cc(F)c(C#CC(F)(F)F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C25H15F7O2/c1-2-3-14-4-6-15(7-5-14)16-10-21(28)23(22(29)11-16)24(33)34-17-12-19(26)18(20(27)13-17)8-9-25(30,31)32/h4-7,10-13H,2-3H2,1H3 |
| InChIKey | RCMDVACEHQEVIL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|