C28H18ClF5O2 — CID 59303977
[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] 2-chloro-6-fluoro-4-(4-propylphenyl)benzoate (PubChem CID 59303977) has the molecular formula C28H18ClF5O2 and a molecular weight of 516.89 g/mol. Its IUPAC name is [3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] 2-chloro-6-fluoro-4-(4-propylphenyl)benzoate.
| Compound Name | [3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] 2-chloro-6-fluoro-4-(4-propylphenyl)benzoate |
|---|---|
| PubChem CID | 59303977 |
| Molecular Formula | C28H18ClF5O2 |
| Molecular Weight | 516.89 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | [3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] 2-chloro-6-fluoro-4-(4-propylphenyl)benzoate |
| SMILES | CCCc1ccc(-c2cc(F)c(C(=O)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H18ClF5O2/c1-2-3-15-4-6-16(7-5-15)17-10-21(29)26(23(31)11-17)28(35)36-19-8-9-20(22(30)14-19)18-12-24(32)27(34)25(33)13-18/h4-14H,2-3H2,1H3 |
| InChIKey | UMSCVTFJIYHCTC-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.89 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|