C30H22F6OS — CID 165144336
O-(3,4,5-trifluorophenyl) 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzenecarbothioate (PubChem CID 165144336) has the molecular formula C30H22F6OS and a molecular weight of 544.56 g/mol. Its IUPAC name is O-(3,4,5-trifluorophenyl) 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzenecarbothioate.
| Compound Name | O-(3,4,5-trifluorophenyl) 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzenecarbothioate |
|---|---|
| PubChem CID | 165144336 |
| Molecular Formula | C30H22F6OS |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | O-(3,4,5-trifluorophenyl) 2,6-difluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzenecarbothioate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(C(=S)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H22F6OS/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-11-22(23(31)12-19)20-13-24(32)28(25(33)14-20)30(38)37-21-15-26(34)29(36)27(35)16-21/h6-16H,2-5H2,1H3 |
| InChIKey | GPINYXKGPMLKOD-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|