C29H20F6OS — CID 170693074
O-(3,4,5-trifluorophenyl) 4-[4-(4-butylphenyl)-2-fluorophenyl]-2,6-difluorobenzenecarbothioate (PubChem CID 170693074) has the molecular formula C29H20F6OS and a molecular weight of 530.53 g/mol. Its IUPAC name is O-(3,4,5-trifluorophenyl) 4-[4-(4-butylphenyl)-2-fluorophenyl]-2,6-difluorobenzenecarbothioate.
| Compound Name | O-(3,4,5-trifluorophenyl) 4-[4-(4-butylphenyl)-2-fluorophenyl]-2,6-difluorobenzenecarbothioate |
|---|---|
| PubChem CID | 170693074 |
| Molecular Formula | C29H20F6OS |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | O-(3,4,5-trifluorophenyl) 4-[4-(4-butylphenyl)-2-fluorophenyl]-2,6-difluorobenzenecarbothioate |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(F)c(C(=S)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C29H20F6OS/c1-2-3-4-16-5-7-17(8-6-16)18-9-10-21(22(30)11-18)19-12-23(31)27(24(32)13-19)29(37)36-20-14-25(33)28(35)26(34)15-20/h5-15H,2-4H2,1H3 |
| InChIKey | XGTYSVJSIFHTRE-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|