C28H18Cl2F4IO2- — CID 163992953
(4-chloro-3,5-difluorophenyl) 2-chloro-6-fluoro-4-[2-fluoro-4-(4-propyliodanuidylphenyl)phenyl]benzoate (PubChem CID 163992953) has the molecular formula C28H18Cl2F4IO2- and a molecular weight of 660.25 g/mol. Its IUPAC name is (4-chloro-3,5-difluorophenyl) 2-chloro-6-fluoro-4-[2-fluoro-4-(4-propyliodanuidylphenyl)phenyl]benzoate.
| Compound Name | (4-chloro-3,5-difluorophenyl) 2-chloro-6-fluoro-4-[2-fluoro-4-(4-propyliodanuidylphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 163992953 |
| Molecular Formula | C28H18Cl2F4IO2- |
| Molecular Weight | 660.25 g/mol |
| Exact Mass | 658.97 |
| IUPAC Name | (4-chloro-3,5-difluorophenyl) 2-chloro-6-fluoro-4-[2-fluoro-4-(4-propyliodanuidylphenyl)phenyl]benzoate |
| SMILES | CCC[I-]c1ccc(-c2ccc(-c3cc(F)c(C(=O)Oc4cc(F)c(Cl)c(F)c4)c(Cl)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H18Cl2F4IO2/c1-2-9-35-18-6-3-15(4-7-18)16-5-8-20(22(31)11-16)17-10-21(29)26(23(32)12-17)28(36)37-19-13-24(33)27(30)25(34)14-19/h3-8,10-14H,2,9H2,1H3/q-1 |
| InChIKey | SXSCWPGNMBHOMO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|