C27H21F7O4 — CID 118601487
1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-2,3-difluorophenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 118601487) has the molecular formula C27H21F7O4 and a molecular weight of 542.45 g/mol. Its IUPAC name is 1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-2,3-difluorophenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-2,3-difluorophenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 118601487 |
| Molecular Formula | C27H21F7O4 |
| Molecular Weight | 542.45 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-2,3-difluorophenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCC12COC(c3ccc(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)cc4)c(F)c3F)(OC1)OC2 |
| InChI | InChI=1S/C27H21F7O4/c1-2-9-25-12-35-27(36-13-25,37-14-25)19-8-7-18(22(30)23(19)31)15-3-5-16(6-4-15)26(33,34)38-17-10-20(28)24(32)21(29)11-17/h3-8,10-11H,2,9,12-14H2,1H3 |
| InChIKey | GVPAEVWJAPHYQD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.45 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|