C28H28F2O2 — CID 21248647
[4-(3,4-difluorophenyl)phenyl] 4-(1-propylcyclohexyl)benzoate (PubChem CID 21248647) has the molecular formula C28H28F2O2 and a molecular weight of 434.53 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)phenyl] 4-(1-propylcyclohexyl)benzoate.
| Compound Name | [4-(3,4-difluorophenyl)phenyl] 4-(1-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 21248647 |
| Molecular Formula | C28H28F2O2 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [4-(3,4-difluorophenyl)phenyl] 4-(1-propylcyclohexyl)benzoate |
| SMILES | CCCC1(c2ccc(C(=O)Oc3ccc(-c4ccc(F)c(F)c4)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C28H28F2O2/c1-2-16-28(17-4-3-5-18-28)23-11-6-21(7-12-23)27(31)32-24-13-8-20(9-14-24)22-10-15-25(29)26(30)19-22/h6-15,19H,2-5,16-18H2,1H3 |
| InChIKey | QGSNNOIMWBPUSQ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|