C17H12F2O4 — CID 18993852
(3,4-difluorophenyl) 4-[(E)-but-2-enoyl]oxybenzoate (PubChem CID 18993852) has the molecular formula C17H12F2O4 and a molecular weight of 318.28 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-[(E)-but-2-enoyl]oxybenzoate.
| Compound Name | (3,4-difluorophenyl) 4-[(E)-but-2-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 18993852 |
| Molecular Formula | C17H12F2O4 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (3,4-difluorophenyl) 4-[(E)-but-2-enoyl]oxybenzoate |
| SMILES | C/C=C/C(=O)Oc1ccc(C(=O)Oc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H12F2O4/c1-2-3-16(20)22-12-6-4-11(5-7-12)17(21)23-13-8-9-14(18)15(19)10-13/h2-10H,1H3/b3-2+ |
| InChIKey | OEGHXVHOBJWCIK-NSCUHMNNSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|