C24H25F3O4 — CID 18993843
(3,4,5-trifluorophenyl) 4-[(E)-undec-2-enoyl]oxybenzoate (PubChem CID 18993843) has the molecular formula C24H25F3O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[(E)-undec-2-enoyl]oxybenzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[(E)-undec-2-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 18993843 |
| Molecular Formula | C24H25F3O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[(E)-undec-2-enoyl]oxybenzoate |
| SMILES | CCCCCCCC/C=C/C(=O)Oc1ccc(C(=O)Oc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C24H25F3O4/c1-2-3-4-5-6-7-8-9-10-22(28)30-18-13-11-17(12-14-18)24(29)31-19-15-20(25)23(27)21(26)16-19/h9-16H,2-8H2,1H3/b10-9+ |
| InChIKey | XVULOHFTBKYDLQ-MDZDMXLPSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|