C25H23FO2 — CID 161174034
[4-[(1S,2R)-2-ethyl-1-fluorocyclopropyl]phenyl] 4-(4-methylphenyl)benzoate (PubChem CID 161174034) has the molecular formula C25H23FO2 and a molecular weight of 374.46 g/mol. Its IUPAC name is [4-[(1S,2R)-2-ethyl-1-fluorocyclopropyl]phenyl] 4-(4-methylphenyl)benzoate.
| Compound Name | [4-[(1S,2R)-2-ethyl-1-fluorocyclopropyl]phenyl] 4-(4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 161174034 |
| Molecular Formula | C25H23FO2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [4-[(1S,2R)-2-ethyl-1-fluorocyclopropyl]phenyl] 4-(4-methylphenyl)benzoate |
| SMILES | CC[C@@H]1C[C@@]1(F)c1ccc(OC(=O)c2ccc(-c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H23FO2/c1-3-21-16-25(21,26)22-12-14-23(15-13-22)28-24(27)20-10-8-19(9-11-20)18-6-4-17(2)5-7-18/h4-15,21H,3,16H2,1-2H3/t21-,25+/m1/s1 |
| InChIKey | VMZBUPZZVFAHQF-BWKNWUBXSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|