C22H23F3O5 — CID 126725292
4-propyl-1-[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 126725292) has the molecular formula C22H23F3O5 and a molecular weight of 424.42 g/mol. Its IUPAC name is 4-propyl-1-[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 4-propyl-1-[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 126725292 |
| Molecular Formula | C22H23F3O5 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-propyl-1-[4-[(3,4,5-trifluorophenoxy)methoxymethyl]phenyl]-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCC12COC(c3ccc(COCOc4cc(F)c(F)c(F)c4)cc3)(OC1)OC2 |
| InChI | InChI=1S/C22H23F3O5/c1-2-7-21-11-28-22(29-12-21,30-13-21)16-5-3-15(4-6-16)10-26-14-27-17-8-18(23)20(25)19(24)9-17/h3-6,8-9H,2,7,10-14H2,1H3 |
| InChIKey | LSHGKPJEUYVRNS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|