C28H32F4O3 — CID 70810720
1-[4-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 70810720) has the molecular formula C28H32F4O3 and a molecular weight of 492.55 g/mol. Its IUPAC name is 1-[4-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 70810720 |
| Molecular Formula | C28H32F4O3 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-[4-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCC12COC(C3CCC(CCc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)CC3)(OC1)OC2 |
| InChI | InChI=1S/C28H32F4O3/c1-2-11-27-15-33-28(34-16-27,35-17-27)21-8-5-18(6-9-21)3-4-19-7-10-22(23(29)12-19)20-13-24(30)26(32)25(31)14-20/h7,10,12-14,18,21H,2-6,8-9,11,15-17H2,1H3 |
| InChIKey | QPYUATQZADIIQN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|