C22H22BF7O3 — CID 87893404
5-butyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-ethyl-1,3,2-dioxaborinane (PubChem CID 87893404) has the molecular formula C22H22BF7O3 and a molecular weight of 478.21 g/mol. Its IUPAC name is 5-butyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-ethyl-1,3,2-dioxaborinane.
| Compound Name | 5-butyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-ethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 87893404 |
| Molecular Formula | C22H22BF7O3 |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 5-butyl-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-ethyl-1,3,2-dioxaborinane |
| SMILES | CCCCC1(CC)COB(c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H22BF7O3/c1-3-5-6-21(4-2)11-31-23(32-12-21)13-7-15(24)19(16(25)8-13)22(29,30)33-14-9-17(26)20(28)18(27)10-14/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | YQSMCOUMXKZOEG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|