C32H28F2O10 — CID 158984686
[3,5-difluoro-4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate (PubChem CID 158984686) has the molecular formula C32H28F2O10 and a molecular weight of 610.56 g/mol. Its IUPAC name is [3,5-difluoro-4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate.
| Compound Name | [3,5-difluoro-4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate |
|---|---|
| PubChem CID | 158984686 |
| Molecular Formula | C32H28F2O10 |
| Molecular Weight | 610.56 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | [3,5-difluoro-4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2cc(F)c(OC(=O)c3ccc(OCCCOC(=O)C=C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C32H28F2O10/c1-3-28(35)41-17-5-15-39-23-11-7-21(8-12-23)31(37)43-25-19-26(33)30(27(34)20-25)44-32(38)22-9-13-24(14-10-22)40-16-6-18-42-29(36)4-2/h3-4,7-14,19-20H,1-2,5-6,15-18H2 |
| InChIKey | AYEGDONOJQNKPU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|