C51H41BrO4 — CID 129041353
[2-(7-bromo-9,9-dimethylfluoren-2-yl)-7-(9,9-dimethylfluoren-2-yl)-9-(prop-2-enoyloxymethyl)fluoren-9-yl]methyl prop-2-enoate (PubChem CID 129041353) has the molecular formula C51H41BrO4 and a molecular weight of 797.79 g/mol. Its IUPAC name is [2-(7-bromo-9,9-dimethylfluoren-2-yl)-7-(9,9-dimethylfluoren-2-yl)-9-(prop-2-enoyloxymethyl)fluoren-9-yl]methyl prop-2-enoate.
| Compound Name | [2-(7-bromo-9,9-dimethylfluoren-2-yl)-7-(9,9-dimethylfluoren-2-yl)-9-(prop-2-enoyloxymethyl)fluoren-9-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 129041353 |
| Molecular Formula | C51H41BrO4 |
| Molecular Weight | 797.79 g/mol |
| Exact Mass | 796.22 |
| IUPAC Name | [2-(7-bromo-9,9-dimethylfluoren-2-yl)-7-(9,9-dimethylfluoren-2-yl)-9-(prop-2-enoyloxymethyl)fluoren-9-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(COC(=O)C=C)c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(Br)ccc3-4)cc21 |
| InChI | InChI=1S/C51H41BrO4/c1-7-47(53)55-28-51(29-56-48(54)8-2)45-25-32(30-13-18-36-35-11-9-10-12-41(35)49(3,4)42(36)23-30)15-20-39(45)40-21-16-33(26-46(40)51)31-14-19-37-38-22-17-34(52)27-44(38)50(5,6)43(37)24-31/h7-27H,1-2,28-29H2,3-6H3 |
| InChIKey | LWHZCESQKXLALS-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.79 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|