C36H31ClO2 — CID 129056379
3-[2-(7-chloro-9,9-dimethylfluoren-2-yl)-9-ethenylfluoren-9-yl]propyl prop-2-enoate (PubChem CID 129056379) has the molecular formula C36H31ClO2 and a molecular weight of 531.10 g/mol. Its IUPAC name is 3-[2-(7-chloro-9,9-dimethylfluoren-2-yl)-9-ethenylfluoren-9-yl]propyl prop-2-enoate.
| Compound Name | 3-[2-(7-chloro-9,9-dimethylfluoren-2-yl)-9-ethenylfluoren-9-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 129056379 |
| Molecular Formula | C36H31ClO2 |
| Molecular Weight | 531.10 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 3-[2-(7-chloro-9,9-dimethylfluoren-2-yl)-9-ethenylfluoren-9-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1(C=C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(Cl)ccc3-4)cc21 |
| InChI | InChI=1S/C36H31ClO2/c1-5-34(38)39-19-9-18-36(6-2)30-11-8-7-10-26(30)29-16-13-24(21-33(29)36)23-12-15-27-28-17-14-25(37)22-32(28)35(3,4)31(27)20-23/h5-8,10-17,20-22H,1-2,9,18-19H2,3-4H3 |
| InChIKey | GOKBPDIFXGVETN-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.10 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|