C58H52O4 — CID 118652584
3-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(prop-2-enoyloxymethyl)fluoren-9-yl]propyl prop-2-enoate (PubChem CID 118652584) has the molecular formula C58H52O4 and a molecular weight of 813.05 g/mol. Its IUPAC name is 3-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(prop-2-enoyloxymethyl)fluoren-9-yl]propyl prop-2-enoate.
| Compound Name | 3-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(prop-2-enoyloxymethyl)fluoren-9-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 118652584 |
| Molecular Formula | C58H52O4 |
| Molecular Weight | 813.05 g/mol |
| Exact Mass | 812.39 |
| IUPAC Name | 3-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(prop-2-enoyloxymethyl)fluoren-9-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1(COC(=O)C=C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(C5=CC=C6C=CC7=CC(C(C)(C)C)=CC8=CC=C5C6C87)ccc3-4)cc21 |
| InChI | InChI=1S/C58H52O4/c1-8-52(59)61-28-12-27-58(34-62-53(60)9-2)48-14-11-10-13-43(48)46-24-19-37(32-51(46)58)36-18-23-44-45-25-20-38(33-50(45)57(6,7)49(44)31-36)42-22-17-35-15-16-39-29-41(56(3,4)5)30-40-21-26-47(42)55(35)54(39)40/h8-11,13-26,29-33,54-55H,1-2,12,27-28,34H2,3-7H3 |
| InChIKey | HXWBCJSUOCKVSB-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.05 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|