C58H54O2 — CID 118655175
4-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-prop-1-en-2-ylfluoren-9-yl]butyl prop-2-enoate (PubChem CID 118655175) has the molecular formula C58H54O2 and a molecular weight of 783.07 g/mol. Its IUPAC name is 4-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-prop-1-en-2-ylfluoren-9-yl]butyl prop-2-enoate.
| Compound Name | 4-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-prop-1-en-2-ylfluoren-9-yl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 118655175 |
| Molecular Formula | C58H54O2 |
| Molecular Weight | 783.07 g/mol |
| Exact Mass | 782.41 |
| IUPAC Name | 4-[2-[7-(7-tert-butyl-10b,10c-dihydropyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-prop-1-en-2-ylfluoren-9-yl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC1(C(=C)C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(C5=CC=C6C=CC7=CC(C(C)(C)C)=CC8=CC=C5C6C87)ccc3-4)cc21 |
| InChI | InChI=1S/C58H54O2/c1-9-53(59)60-29-13-12-28-58(35(2)3)49-15-11-10-14-44(49)47-25-20-38(33-52(47)58)37-19-24-45-46-26-21-39(34-51(46)57(7,8)50(45)32-37)43-23-18-36-16-17-40-30-42(56(4,5)6)31-41-22-27-48(43)55(36)54(40)41/h9-11,14-27,30-34,54-55H,1-2,12-13,28-29H2,3-8H3 |
| InChIKey | FQXKVCASKGXTLT-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.07 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|