C75H59F3 — CID 59245648
2,3,6,7-tetrakis(9,9-dimethylfluoren-2-yl)-9-methyl-9-(trifluoromethyl)fluorene (PubChem CID 59245648) has the molecular formula C75H59F3 and a molecular weight of 1017.29 g/mol. Its IUPAC name is 2,3,6,7-tetrakis(9,9-dimethylfluoren-2-yl)-9-methyl-9-(trifluoromethyl)fluorene.
| Compound Name | 2,3,6,7-tetrakis(9,9-dimethylfluoren-2-yl)-9-methyl-9-(trifluoromethyl)fluorene |
|---|---|
| PubChem CID | 59245648 |
| Molecular Formula | C75H59F3 |
| Molecular Weight | 1017.29 g/mol |
| Exact Mass | 1016.46 |
| IUPAC Name | 2,3,6,7-tetrakis(9,9-dimethylfluoren-2-yl)-9-methyl-9-(trifluoromethyl)fluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc4c(cc3-c3ccc5c(c3)C(C)(C)c3ccccc3-5)C(C)(C(F)(F)F)c3cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)c(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc3-4)cc21 |
| InChI | InChI=1S/C75H59F3/c1-70(2)60-22-14-10-18-46(60)50-30-26-42(34-64(50)70)54-38-58-59-39-55(43-27-31-51-47-19-11-15-23-61(47)71(3,4)65(51)35-43)57(45-29-33-53-49-21-13-17-25-63(49)73(7,8)67(53)37-45)41-69(59)74(9,75(76,77)78)68(58)40-56(54)44-28-32-52-48-20-12-16-24-62(48)72(5,6)66(52)36-44/h10-41H,1-9H3 |
| InChIKey | ZQXDNWIPPVSODC-UHFFFAOYSA-N |
| XLogP | 20.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.29 |
| LogP ≤ 5 | 20.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |