C59H44F6 — CID 59245613
9,9-diethyl-2,7-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-3,6-diphenylfluorene (PubChem CID 59245613) has the molecular formula C59H44F6 and a molecular weight of 866.99 g/mol. Its IUPAC name is 9,9-diethyl-2,7-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-3,6-diphenylfluorene.
| Compound Name | 9,9-diethyl-2,7-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-3,6-diphenylfluorene |
|---|---|
| PubChem CID | 59245613 |
| Molecular Formula | C59H44F6 |
| Molecular Weight | 866.99 g/mol |
| Exact Mass | 866.33 |
| IUPAC Name | 9,9-diethyl-2,7-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-3,6-diphenylfluorene |
| SMILES | CCC1(CC)c2cc(-c3ccc4c(c3)C(C)(C(F)(F)F)c3ccccc3-4)c(-c3ccccc3)cc2-c2cc(-c3ccccc3)c(-c3ccc4c(c3)C(C)(C(F)(F)F)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C59H44F6/c1-5-57(6-2)53-33-45(37-25-27-41-39-21-13-15-23-49(39)55(3,51(41)29-37)58(60,61)62)43(35-17-9-7-10-18-35)31-47(53)48-32-44(36-19-11-8-12-20-36)46(34-54(48)57)38-26-28-42-40-22-14-16-24-50(40)56(4,52(42)30-38)59(63,64)65/h7-34H,5-6H2,1-4H3 |
| InChIKey | UWYPRCOAAAMMGF-UHFFFAOYSA-N |
| XLogP | 17.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.99 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |