C77H42F24 — CID 59245644
2,3,6,7-tetrakis[9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-diethylfluorene (PubChem CID 59245644) has the molecular formula C77H42F24 and a molecular weight of 1423.13 g/mol. Its IUPAC name is 2,3,6,7-tetrakis[9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-diethylfluorene.
| Compound Name | 2,3,6,7-tetrakis[9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-diethylfluorene |
|---|---|
| PubChem CID | 59245644 |
| Molecular Formula | C77H42F24 |
| Molecular Weight | 1423.13 g/mol |
| Exact Mass | 1422.29 |
| IUPAC Name | 2,3,6,7-tetrakis[9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2cc(-c3ccc4c(c3)C(C(F)(F)F)(C(F)(F)F)c3ccccc3-4)c(-c3ccc4c(c3)C(C(F)(F)F)(C(F)(F)F)c3ccccc3-4)cc2-c2cc(-c3ccc4c(c3)C(C(F)(F)F)(C(F)(F)F)c3ccccc3-4)c(-c3ccc4c(c3)C(C(F)(F)F)(C(F)(F)F)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C77H42F24/c1-3-65(4-2)59-35-51(39-23-27-47-43-15-7-11-19-57(43)68(63(47)31-39,74(90,91)92)75(93,94)95)49(37-21-25-45-41-13-5-9-17-55(41)66(61(45)29-37,70(78,79)80)71(81,82)83)33-53(59)54-34-50(38-22-26-46-42-14-6-10-18-56(42)67(62(46)30-38,72(84,85)86)73(87,88)89)52(36-60(54)65)40-24-28-48-44-16-8-12-20-58(44)69(64(48)32-40,76(96,97)98)77(99,100)101/h5-36H,3-4H2,1-2H3 |
| InChIKey | KRMGJUPVTZVEIA-UHFFFAOYSA-N |
| XLogP | 25.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1423.13 |
| LogP ≤ 5 | 25.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |