C63H42F6 — CID 88882577
2-[9,9-bis(trifluoromethyl)fluoren-2-yl]-6,12-bis(9,9-dimethylfluoren-2-yl)chrysene (PubChem CID 88882577) has the molecular formula C63H42F6 and a molecular weight of 913.02 g/mol. Its IUPAC name is 2-[9,9-bis(trifluoromethyl)fluoren-2-yl]-6,12-bis(9,9-dimethylfluoren-2-yl)chrysene.
| Compound Name | 2-[9,9-bis(trifluoromethyl)fluoren-2-yl]-6,12-bis(9,9-dimethylfluoren-2-yl)chrysene |
|---|---|
| PubChem CID | 88882577 |
| Molecular Formula | C63H42F6 |
| Molecular Weight | 913.02 g/mol |
| Exact Mass | 912.32 |
| IUPAC Name | 2-[9,9-bis(trifluoromethyl)fluoren-2-yl]-6,12-bis(9,9-dimethylfluoren-2-yl)chrysene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc4c5ccc(-c6ccc7c(c6)C(C(F)(F)F)(C(F)(F)F)c6ccccc6-7)cc5c(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4c4ccccc34)cc21 |
| InChI | InChI=1S/C63H42F6/c1-59(2)53-18-10-7-15-42(53)45-27-23-37(31-56(45)59)48-33-52-41-25-21-35(36-22-26-47-44-17-9-12-20-55(44)61(58(47)30-36,62(64,65)66)63(67,68)69)29-50(41)49(34-51(52)40-14-6-5-13-39(40)48)38-24-28-46-43-16-8-11-19-54(43)60(3,4)57(46)32-38/h5-34H,1-4H3 |
| InChIKey | RJLUSNRZHGSDCG-UHFFFAOYSA-N |
| XLogP | 18.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.02 |
| LogP ≤ 5 | 18.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|