C51H37F3 — CID 59196207
2,9-bis(9,9-dimethylfluoren-2-yl)-10-[4-(trifluoromethyl)phenyl]anthracene (PubChem CID 59196207) has the molecular formula C51H37F3 and a molecular weight of 706.85 g/mol. Its IUPAC name is 2,9-bis(9,9-dimethylfluoren-2-yl)-10-[4-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 2,9-bis(9,9-dimethylfluoren-2-yl)-10-[4-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 59196207 |
| Molecular Formula | C51H37F3 |
| Molecular Weight | 706.85 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | 2,9-bis(9,9-dimethylfluoren-2-yl)-10-[4-(trifluoromethyl)phenyl]anthracene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(-c5ccc(C(F)(F)F)cc5)c5ccccc5c(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)c4c3)cc21 |
| InChI | InChI=1S/C51H37F3/c1-49(2)43-15-9-7-11-35(43)37-24-19-32(28-45(37)49)31-20-26-41-42(27-31)48(33-21-25-38-36-12-8-10-16-44(36)50(3,4)46(38)29-33)40-14-6-5-13-39(40)47(41)30-17-22-34(23-18-30)51(52,53)54/h5-29H,1-4H3 |
| InChIKey | XLOQLOVXWRJQNU-UHFFFAOYSA-N |
| XLogP | 14.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.85 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|