C50H38O5 — CID 149227774
6-[9,10-bis(9,9-dimethylfluoren-2-yl)anthracen-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 149227774) has the molecular formula C50H38O5 and a molecular weight of 718.85 g/mol. Its IUPAC name is 6-[9,10-bis(9,9-dimethylfluoren-2-yl)anthracen-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[9,10-bis(9,9-dimethylfluoren-2-yl)anthracen-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 149227774 |
| Molecular Formula | C50H38O5 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | 6-[9,10-bis(9,9-dimethylfluoren-2-yl)anthracen-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4cc(-c5c(O)c(O)c(O)c(O)c5O)ccc34)cc21 |
| InChI | InChI=1S/C50H38O5/c1-49(2)37-15-9-7-11-29(37)31-20-17-27(24-39(31)49)41-33-13-5-6-14-34(33)42(28-18-21-32-30-12-8-10-16-38(30)50(3,4)40(32)25-28)36-23-26(19-22-35(36)41)43-44(51)46(53)48(55)47(54)45(43)52/h5-25,51-55H,1-4H3 |
| InChIKey | XJSBYLKRZUEUBB-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|