C68H55Si+ — CID 144661915
[2-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(4-phenylnaphthalen-1-yl)anthracen-2-yl]phenyl]-dimethylsilanylium (PubChem CID 144661915) has the molecular formula C68H55Si+ and a molecular weight of 900.27 g/mol. Its IUPAC name is [2-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(4-phenylnaphthalen-1-yl)anthracen-2-yl]phenyl]-dimethylsilanylium.
| Compound Name | [2-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(4-phenylnaphthalen-1-yl)anthracen-2-yl]phenyl]-dimethylsilanylium |
|---|---|
| PubChem CID | 144661915 |
| Molecular Formula | C68H55Si+ |
| Molecular Weight | 900.27 g/mol |
| Exact Mass | 899.41 |
| IUPAC Name | [2-[9,10-bis(9,9-dimethylfluoren-2-yl)-6-(4-phenylnaphthalen-1-yl)anthracen-2-yl]phenyl]-dimethylsilanylium |
| SMILES | C[SiH2+](C)c1ccccc1-c1ccc2c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3cc(-c4ccc(-c5ccccc5)c5ccccc45)ccc3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2c1 |
| InChI | InChI=1S/C68H55Si/c1-67(2)60-25-15-12-23-52(60)54-32-30-45(40-62(54)67)65-57-35-29-44(49-20-14-17-27-64(49)69(5)6)39-59(57)66(46-31-33-55-53-24-13-16-26-61(53)68(3,4)63(55)41-46)56-34-28-43(38-58(56)65)48-37-36-47(42-18-8-7-9-19-42)50-21-10-11-22-51(48)50/h7-41H,69H2,1-6H3/q+1 |
| InChIKey | VKIPZLAYWQCDKO-UHFFFAOYSA-N |
| XLogP | 17.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.27 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|