C30H19BrF6 — CID 59512956
2-bromo-9-methyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-9-(trifluoromethyl)fluorene (PubChem CID 59512956) has the molecular formula C30H19BrF6 and a molecular weight of 573.37 g/mol. Its IUPAC name is 2-bromo-9-methyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-9-(trifluoromethyl)fluorene.
| Compound Name | 2-bromo-9-methyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-9-(trifluoromethyl)fluorene |
|---|---|
| PubChem CID | 59512956 |
| Molecular Formula | C30H19BrF6 |
| Molecular Weight | 573.37 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 2-bromo-9-methyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-9-(trifluoromethyl)fluorene |
| SMILES | CC1(C(F)(F)F)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C(F)(F)F)c3cc(Br)ccc3-4)cc21 |
| InChI | InChI=1S/C30H19BrF6/c1-27(29(32,33)34)23-6-4-3-5-19(23)20-10-7-16(13-24(20)27)17-8-11-21-22-12-9-18(31)15-26(22)28(2,25(21)14-17)30(35,36)37/h3-15H,1-2H3 |
| InChIKey | ORKXNSCBADKSOX-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.37 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |