C50H30F6 — CID 59404128
7,12-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]benzo[k]fluoranthene (PubChem CID 59404128) has the molecular formula C50H30F6 and a molecular weight of 744.78 g/mol. Its IUPAC name is 7,12-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]benzo[k]fluoranthene.
| Compound Name | 7,12-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]benzo[k]fluoranthene |
|---|---|
| PubChem CID | 59404128 |
| Molecular Formula | C50H30F6 |
| Molecular Weight | 744.78 g/mol |
| Exact Mass | 744.23 |
| IUPAC Name | 7,12-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]benzo[k]fluoranthene |
| SMILES | CC1(C(F)(F)F)c2ccccc2-c2ccc(-c3c4c(c(-c5ccc6c(c5)C(C)(C(F)(F)F)c5ccccc5-6)c5ccccc35)-c3cccc5cccc-4c35)cc21 |
| InChI | InChI=1S/C50H30F6/c1-47(49(51,52)53)38-19-7-5-13-30(38)32-23-21-28(25-40(32)47)43-34-15-3-4-16-35(34)44(46-37-18-10-12-27-11-9-17-36(42(27)37)45(43)46)29-22-24-33-31-14-6-8-20-39(31)48(2,41(33)26-29)50(54,55)56/h3-26H,1-2H3 |
| InChIKey | NQFOBBZVZXMZEO-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.78 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |