C62H60 — CID 59404113
7,12-bis(9,9-ditert-butylfluoren-2-yl)benzo[k]fluoranthene (PubChem CID 59404113) has the molecular formula C62H60 and a molecular weight of 805.16 g/mol. Its IUPAC name is 7,12-bis(9,9-ditert-butylfluoren-2-yl)benzo[k]fluoranthene.
| Compound Name | 7,12-bis(9,9-ditert-butylfluoren-2-yl)benzo[k]fluoranthene |
|---|---|
| PubChem CID | 59404113 |
| Molecular Formula | C62H60 |
| Molecular Weight | 805.16 g/mol |
| Exact Mass | 804.47 |
| IUPAC Name | 7,12-bis(9,9-ditert-butylfluoren-2-yl)benzo[k]fluoranthene |
| SMILES | CC(C)(C)C1(C(C)(C)C)c2ccccc2-c2ccc(-c3c4c(c(-c5ccc6c(c5)C(C(C)(C)C)(C(C)(C)C)c5ccccc5-6)c5ccccc35)-c3cccc5cccc-4c35)cc21 |
| InChI | InChI=1S/C62H60/c1-57(2,3)61(58(4,5)6)48-29-17-15-23-40(48)42-33-31-38(35-50(42)61)53-44-25-13-14-26-45(44)54(56-47-28-20-22-37-21-19-27-46(52(37)47)55(53)56)39-32-34-43-41-24-16-18-30-49(41)62(51(43)36-39,59(7,8)9)60(10,11)12/h13-36H,1-12H3 |
| InChIKey | YZIDCQZEFASOQE-UHFFFAOYSA-N |
| XLogP | 17.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.16 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |