C19H26O4 — CID 123283995
6-prop-2-enoyloxyhexyl 2,3,5-trimethylbenzoate (PubChem CID 123283995) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 2,3,5-trimethylbenzoate.
| Compound Name | 6-prop-2-enoyloxyhexyl 2,3,5-trimethylbenzoate |
|---|---|
| PubChem CID | 123283995 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl 2,3,5-trimethylbenzoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)c1cc(C)cc(C)c1C |
| InChI | InChI=1S/C19H26O4/c1-5-18(20)22-10-8-6-7-9-11-23-19(21)17-13-14(2)12-15(3)16(17)4/h5,12-13H,1,6-11H2,2-4H3 |
| InChIKey | QWLXGKUQKOWPAL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|