C22H23N3O4 — CID 171768564
5-prop-2-enoyloxypentyl 2-(benzotriazol-2-yl)-4-methylbenzoate (PubChem CID 171768564) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-prop-2-enoyloxypentyl 2-(benzotriazol-2-yl)-4-methylbenzoate.
| Compound Name | 5-prop-2-enoyloxypentyl 2-(benzotriazol-2-yl)-4-methylbenzoate |
|---|---|
| PubChem CID | 171768564 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-prop-2-enoyloxypentyl 2-(benzotriazol-2-yl)-4-methylbenzoate |
| SMILES | C=CC(=O)OCCCCCOC(=O)c1ccc(C)cc1-n1nc2ccccc2n1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-21(26)28-13-7-4-8-14-29-22(27)17-12-11-16(2)15-20(17)25-23-18-9-5-6-10-19(18)24-25/h3,5-6,9-12,15H,1,4,7-8,13-14H2,2H3 |
| InChIKey | SQFKVQDJZXALOK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|