C22H22O3 — CID 155221904
4-[(2-phenyl-3H-inden-5-yl)oxy]butyl prop-2-enoate (PubChem CID 155221904) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[(2-phenyl-3H-inden-5-yl)oxy]butyl prop-2-enoate.
| Compound Name | 4-[(2-phenyl-3H-inden-5-yl)oxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 155221904 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-[(2-phenyl-3H-inden-5-yl)oxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc2c(c1)CC(c1ccccc1)=C2 |
| InChI | InChI=1S/C22H22O3/c1-2-22(23)25-13-7-6-12-24-21-11-10-18-14-19(15-20(18)16-21)17-8-4-3-5-9-17/h2-5,8-11,14,16H,1,6-7,12-13,15H2 |
| InChIKey | FYHHITYMZSQJNL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|