C22H26N2O3 — CID 155222302
3-[(6-phenyl-7,8-dihydronaphthalen-2-yl)oxy]propyl 2,3-diaminopropanoate (PubChem CID 155222302) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[(6-phenyl-7,8-dihydronaphthalen-2-yl)oxy]propyl 2,3-diaminopropanoate.
| Compound Name | 3-[(6-phenyl-7,8-dihydronaphthalen-2-yl)oxy]propyl 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 155222302 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[(6-phenyl-7,8-dihydronaphthalen-2-yl)oxy]propyl 2,3-diaminopropanoate |
| SMILES | NCC(N)C(=O)OCCCOc1ccc2c(c1)CCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C22H26N2O3/c23-15-21(24)22(25)27-12-4-11-26-20-10-9-18-13-17(7-8-19(18)14-20)16-5-2-1-3-6-16/h1-3,5-6,9-10,13-14,21H,4,7-8,11-12,15,23-24H2 |
| InChIKey | IAXTVBURJIZMCG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|