C24H30N2O2 — CID 155222274
5-(7-phenyl-5,6-dihydronaphthalen-2-yl)pentyl 2,3-diaminopropanoate (PubChem CID 155222274) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 5-(7-phenyl-5,6-dihydronaphthalen-2-yl)pentyl 2,3-diaminopropanoate.
| Compound Name | 5-(7-phenyl-5,6-dihydronaphthalen-2-yl)pentyl 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 155222274 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 5-(7-phenyl-5,6-dihydronaphthalen-2-yl)pentyl 2,3-diaminopropanoate |
| SMILES | NCC(N)C(=O)OCCCCCc1ccc2c(c1)C=C(c1ccccc1)CC2 |
| InChI | InChI=1S/C24H30N2O2/c25-17-23(26)24(27)28-14-6-2-3-7-18-10-11-20-12-13-21(16-22(20)15-18)19-8-4-1-5-9-19/h1,4-5,8-11,15-16,23H,2-3,6-7,12-14,17,25-26H2 |
| InChIKey | WCSPLURUOVPYOL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|