C33H46O2 — CID 155712315
6-(7-phenyl-5,6-dihydronaphthalen-2-yl)hexyl 2,2,3,5,5-pentamethylhexanoate (PubChem CID 155712315) has the molecular formula C33H46O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 6-(7-phenyl-5,6-dihydronaphthalen-2-yl)hexyl 2,2,3,5,5-pentamethylhexanoate.
| Compound Name | 6-(7-phenyl-5,6-dihydronaphthalen-2-yl)hexyl 2,2,3,5,5-pentamethylhexanoate |
|---|---|
| PubChem CID | 155712315 |
| Molecular Formula | C33H46O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 6-(7-phenyl-5,6-dihydronaphthalen-2-yl)hexyl 2,2,3,5,5-pentamethylhexanoate |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(=O)OCCCCCCc1ccc2c(c1)C=C(c1ccccc1)CC2 |
| InChI | InChI=1S/C33H46O2/c1-25(24-32(2,3)4)33(5,6)31(34)35-21-13-8-7-10-14-26-17-18-28-19-20-29(23-30(28)22-26)27-15-11-9-12-16-27/h9,11-12,15-18,22-23,25H,7-8,10,13-14,19-21,24H2,1-6H3 |
| InChIKey | MWQUJMWRVPCNGN-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|