C27H36N2O3 — CID 155222045
6-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)oxy]hexyl 2,3-diamino-2-methylpropanoate (PubChem CID 155222045) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 6-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)oxy]hexyl 2,3-diamino-2-methylpropanoate.
| Compound Name | 6-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)oxy]hexyl 2,3-diamino-2-methylpropanoate |
|---|---|
| PubChem CID | 155222045 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 6-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)oxy]hexyl 2,3-diamino-2-methylpropanoate |
| SMILES | CC(N)(CN)C(=O)OCCCCCCOc1cccc2c1CCCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C27H36N2O3/c1-27(29,20-28)26(30)32-18-8-3-2-7-17-31-25-16-10-14-23-19-22(13-9-15-24(23)25)21-11-5-4-6-12-21/h4-6,10-12,14,16,19H,2-3,7-9,13,15,17-18,20,28-29H2,1H3 |
| InChIKey | DWZSSWADVPFEGC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|