C25H28O3 — CID 155221940
3-[[(5E)-6-phenyl-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl]oxy]propyl 2-methylprop-2-enoate (PubChem CID 155221940) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[[(5E)-6-phenyl-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl]oxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[(5E)-6-phenyl-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl]oxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155221940 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-[[(5E)-6-phenyl-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl]oxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1cccc2c1/C=C(/c1ccccc1)CCCC2 |
| InChI | InChI=1S/C25H28O3/c1-19(2)25(26)28-17-9-16-27-24-15-8-14-21-12-6-7-13-22(18-23(21)24)20-10-4-3-5-11-20/h3-5,8,10-11,14-15,18H,1,6-7,9,12-13,16-17H2,2H3/b22-18+ |
| InChIKey | HJMDBDQDPYXTME-RELWKKBWSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|