C22H25NO4 — CID 174349764
5-acetyloxypentyl 2-cyano-2-(3-phenylcyclohex-2-en-1-ylidene)acetate (PubChem CID 174349764) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-acetyloxypentyl 2-cyano-2-(3-phenylcyclohex-2-en-1-ylidene)acetate.
| Compound Name | 5-acetyloxypentyl 2-cyano-2-(3-phenylcyclohex-2-en-1-ylidene)acetate |
|---|---|
| PubChem CID | 174349764 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 5-acetyloxypentyl 2-cyano-2-(3-phenylcyclohex-2-en-1-ylidene)acetate |
| SMILES | CC(=O)OCCCCCOC(=O)C(C#N)=C1C=C(c2ccccc2)CCC1 |
| InChI | InChI=1S/C22H25NO4/c1-17(24)26-13-6-3-7-14-27-22(25)21(16-23)20-12-8-11-19(15-20)18-9-4-2-5-10-18/h2,4-5,9-10,15H,3,6-8,11-14H2,1H3 |
| InChIKey | FDNPDQYCLGTGGZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|