About 4-(N-phenylanilino)butyl acetate
4-(N-phenylanilino)butyl acetate (PubChem CID 2782353) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-(N-phenylanilino)butyl acetate.
Molecular Properties
| Compound Name | 4-(N-phenylanilino)butyl acetate |
| PubChem CID | 2782353 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-(N-phenylanilino)butyl acetate |
| SMILES | CC(=O)OCCCCN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-16(20)21-15-9-8-14-19(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13H,8-9,14-15H2,1H3 |
| InChIKey | NXOWSKAKAGDOBG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(N-phenylanilino)butyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N-phenylanilino)butyl acetate?
The IUPAC name of 4-(N-phenylanilino)butyl acetate (CID 2782353) is 4-(N-phenylanilino)butyl acetate.
What is the SMILES notation for 4-(N-phenylanilino)butyl acetate?
The canonical SMILES for 4-(N-phenylanilino)butyl acetate is CC(=O)OCCCCN(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(N-phenylanilino)butyl acetate?
The InChIKey is NXOWSKAKAGDOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-16(20)21-15-9-8-14-19(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13H,8-9,14-15H2,1H3.
What are the key properties of 4-(N-phenylanilino)butyl acetate?
4-(N-phenylanilino)butyl acetate has a molecular weight of 283.37 g/mol, XLogP of 4.17, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N-phenylanilino)butyl acetate is sourced from PubChem (CID 2782353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).